21613-86-5 Usage
General Description
2-Amino-6-hydroxymethyl-purine-8-methanol, also known as formycins, is a class of purine analogues that are known for their potential pharmaceutical applications. 2-Amino-6-hydroxymethyl-purine-8-methanol holds promise in the development of antiviral and anticancer drugs due to its ability to inhibit the replication of certain viruses and cancer cells. Additionally, formycins have shown promising antibacterial activity against a range of pathogens, making them potential candidates for the treatment of various bacterial infections. The chemical structure of 2-Amino-6-hydroxymethyl-purine-8-methanol allows for the modulation of various biological pathways, making it an interesting target for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 21613-86-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,6,1 and 3 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21613-86:
(7*2)+(6*1)+(5*6)+(4*1)+(3*3)+(2*8)+(1*6)=85
85 % 10 = 5
So 21613-86-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5O2/c7-6-10-4-3(5(13)11-6)8-2(1-12)9-4/h12H,1H2,(H4,7,8,9,10,11,13)
