216144-91-1 Usage
Description
3-(2-Carboxyvinyl)benzeneboronic acid is an organic compound with the chemical formula C8H7BO4. It is characterized by the presence of a boronic acid group attached to a benzene ring, which is further substituted with a carboxyvinyl group. This unique structure endows it with versatile chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
3-(2-Carboxyvinyl)benzeneboronic acid is used as a reactant in the synthesis of inhibitors targeting malarial proteases, specifically plasmepsin I and II. These inhibitors are crucial for the development of new antimalarial drugs, as they can help combat the resistance of the Plasmodium parasite to existing treatments.
3-(2-Carboxyvinyl)benzeneboronic acid is also used as an intermediate in the synthesis of azaindoles, which possess antibacterial activity. These compounds can be further developed into new antibiotics to address the growing issue of antibiotic resistance.
Additionally, 3-(2-Carboxyvinyl)benzeneboronic acid is utilized in the synthesis of structure-based inhibitors of AmpC β-Lactamase, an enzyme that can hydrolyze and inactivate β-lactam antibiotics. Inhibitors targeting this enzyme can help restore the effectiveness of β-lactam antibiotics against resistant bacteria.
Furthermore, 3-(2-Carboxyvinyl)benzeneboronic acid is used as an intermediate in the synthesis of Pim-2 kinase inhibitors. Pim-2 kinase is an enzyme involved in cell survival and proliferation, and its inhibition can have potential applications in cancer therapy by targeting the survival and growth of cancer cells.
Check Digit Verification of cas no
The CAS Registry Mumber 216144-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,1,4 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 216144-91:
(8*2)+(7*1)+(6*6)+(5*1)+(4*4)+(3*4)+(2*9)+(1*1)=111
111 % 10 = 1
So 216144-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6,13-14H,(H,11,12)/b5-4+
