216971-58-3 Usage
Description
3-Indolyl--D-glucuronideCyclohexylammoniumsalt, also known as Indoxyl beta-D-Glucuronide Cyclohexylammonium Salt, is a chromogenic substrate primarily utilized in the detection and enumeration of specific bacteria, such as E. coli. It is known for its ability to yield a blue precipitate upon cleavage, making it a valuable tool in various scientific and medical applications.
Uses
Used in Microbial Detection:
3-Indolyl--D-glucuronideCyclohexylammoniumsalt is used as a chromogenic substrate for β-D-glucuronidase, specifically in the detection and enumeration of E. coli. The substrate's ability to produce a blue precipitate upon cleavage allows for the identification and quantification of the bacteria in various samples.
Used in Biological Research:
In the field of biological research, 3-Indolyl--D-glucuronideCyclohexylammoniumsalt is used for the study of isolated peptides and their preparation methods for medicinal uses. Its unique properties make it a valuable tool in understanding the interactions and functions of various peptides in biological systems.
Used in Pharmaceutical Development:
3-Indolyl--D-glucuronideCyclohexylammoniumsalt also has potential applications in the pharmaceutical industry, particularly in the development of new drugs and therapies. Its role in studying isolated peptides and their preparation methods can contribute to the advancement of medicinal treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 216971-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,9,7 and 1 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 216971-58:
(8*2)+(7*1)+(6*6)+(5*9)+(4*7)+(3*1)+(2*5)+(1*8)=153
153 % 10 = 3
So 216971-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO7.C6H13N/c16-9-10(17)12(13(19)20)22-14(11(9)18)21-8-5-15-7-4-2-1-3-6(7)8;7-6-4-2-1-3-5-6/h1-5,9-12,14-18H,(H,19,20);6H,1-5,7H2/t9-,10-,11+,12-,14+;/m0./s1
