22255-16-9 Usage
Description
3-AZABICYCLO[3.1.0]HEXANE-2-CARBOXYLIC ACID, also known as Cis-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, is an organic compound with a unique bicyclic structure. It is characterized by its carboxylic acid functional group and a nitrogen atom within the bicyclic ring system. 3-AZABICYCLO[3.1.0]HEXANE-2-CARBOXYLIC ACID is known for its potential applications in the pharmaceutical industry due to its chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
3-AZABICYCLO[3.1.0]HEXANE-2-CARBOXYLIC ACID is used as a reactant for the preparation of azabicyclohexane derivatives. These derivatives are known for their role as orexin receptor antagonists, which are important in the development of medications targeting various conditions such as insomnia, addiction, and other disorders related to the central nervous system. The compound's reactivity and structural properties make it a valuable building block in the synthesis of these therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 22255-16-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,5 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22255-16:
(7*2)+(6*2)+(5*2)+(4*5)+(3*5)+(2*1)+(1*6)=79
79 % 10 = 9
So 22255-16-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO2/c8-6(9)5-4-1-3(4)2-7-5/h3-5,7H,1-2H2,(H,8,9)/t3-,4-,5-/m1/s1