223537-30-2 Usage
Description
Ethyl (E,4S)-4-[[(2R,5S)-2-[(4-fluorophenyl)methyl]-6-methyl-5-[(5-methoxazole-3-carbonyl)amino]-4-oxo-heptanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate is a complex organic compound with a unique chemical structure. It is characterized by its fluorophenyl and methoxazole moieties, which contribute to its potential biological activities and applications.
Uses
1. Used in Pharmaceutical Applications:
Ethyl (E,4S)-4-[[(2R,5S)-2-[(4-fluorophenyl)methyl]-6-methyl-5-[(5-methoxazole-3-carbonyl)amino]-4-oxo-heptanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate is used as a pharmaceutical compound for its potential therapeutic effects. The compound's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
2. Used in Chemical Research:
ethyl (E,4S)-4-[[(2R,5S)-2-[(4-fluorophenyl)methyl]-6-methyl-5-[(5-met hyloxazole-3-carbonyl)amino]-4-oxo-heptanoyl]amino]-5-[(3S)-2-oxopyrro lidin-3-yl]pent-2-enoate is also used in chemical research as a starting material or intermediate for the synthesis of other complex organic molecules. Its unique structure and functional groups make it a valuable tool for exploring new chemical reactions and developing novel synthetic pathways.
3. Used in Material Science:
Ethyl (E,4S)-4-[[(2R,5S)-2-[(4-fluorophenyl)methyl]-6-methyl-5-[(5-methoxazole-3-carbonyl)amino]-4-oxo-heptanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate may have potential applications in material science due to its unique chemical structure. It could be used to develop new materials with specific properties, such as improved stability, reactivity, or selectivity.
4. Used in Analytical Chemistry:
The compound can be employed in analytical chemistry as a reference material or standard for the development and validation of analytical methods. Its unique structure and properties make it suitable for testing the performance of various analytical techniques, such as chromatography, mass spectrometry, and nuclear magnetic resonance (NMR) spectroscopy.
Biochem/physiol Actions
Rupintrivir (AG7088) is an irreversible human rhinovirus (HRV) 3C protease inhibitor, also found to inhibit enterovirus and norovirus.
Check Digit Verification of cas no
The CAS Registry Mumber 223537-30-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,5,3 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 223537-30:
(8*2)+(7*2)+(6*3)+(5*5)+(4*3)+(3*7)+(2*3)+(1*0)=112
112 % 10 = 2
So 223537-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C31H39FN4O7/c1-5-42-27(38)11-10-24(16-21-12-13-33-29(21)39)34-30(40)22(15-20-6-8-23(32)9-7-20)17-26(37)28(18(2)3)35-31(41)25-14-19(4)43-36-25/h6-11,14,18,21-22,24,28H,5,12-13,15-17H2,1-4H3,(H,33,39)(H,34,40)(H,35,41)/b11-10+/t21-,22+,24+,28-/m0/s1