23364-04-7 Usage
General Description
AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is a chemical compound with the molecular formula C8H13NO2. It is a derivative of cyclohexene with an amino group and a carboxylic acid functional group attached. AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is commonly used in medicinal chemistry and pharmaceutical research, particularly in the development of potential drug candidates. It may exhibit biological activity by interacting with specific targets in the body, making it a valuable tool for investigating potential therapeutic agents. Additionally, its structure and properties make it a versatile building block for the synthesis of various organic compounds with potential pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 23364-04-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,3,6 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 23364-04:
(7*2)+(6*3)+(5*3)+(4*6)+(3*4)+(2*0)+(1*4)=87
87 % 10 = 7
So 23364-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,6-7H,3-5,9H2,(H,10,11)
