235-21-2 Usage
General Description
[1,2,3]Triazolo[1,5-a]quinoline is a chemical compound that has a triazoloquinoline structure, which consists of a quinoline ring fused with a triazole ring. [1,2,3]Triazolo[1,5-a]quinoline has a unique and complex molecular structure, and it exhibits various biological activities. [1,2,3]Triazolo[1,5-a]quinoline derivatives have been studied for their potential pharmacological applications, such as their antimicrobial, antiviral, anticancer, and anticonvulsant properties. These derivatives have also been investigated for their potential as enzyme inhibitors and ligands for various biological targets. The research and development of [1,2,3]Triazolo[1,5-a]quinoline derivatives continue to be of interest in the fields of medicinal chemistry and drug discovery due to their diverse biological activities and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 235-21-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,3 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 235-21:
(5*2)+(4*3)+(3*5)+(2*2)+(1*1)=42
42 % 10 = 2
So 235-21-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3/c1-2-4-10-8(3-1)5-6-9-7-11-12-13(9)10/h1-7H
