23658-67-5 Usage
General Description
1H-Purin-8-amine, N-methyl- (9CI) is a chemical compound that belongs to the class of purine derivatives. It is also known as N-methyladenine or 8-methyladenine. 1H-Purin-8-amine, N-methyl- (9CI) is a derivative of adenine, a component of DNA and RNA molecules. N-methyladenine is commonly found in nucleic acids and plays a crucial role in various biological processes, including energy transfer and signal transduction. It is also used in pharmaceutical research and drug development due to its biological activity. N-methyladenine has potential applications in the treatment of various diseases, including cancer and viral infections.
Check Digit Verification of cas no
The CAS Registry Mumber 23658-67-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,6,5 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23658-67:
(7*2)+(6*3)+(5*6)+(4*5)+(3*8)+(2*6)+(1*7)=125
125 % 10 = 5
So 23658-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c1-7-6-10-4-2-8-3-9-5(4)11-6/h2-3H,1H3,(H2,7,8,9,10,11)
