239466-74-1 Usage
Description
Trans-R-138727, also known as the Prasugrel Metabolite, is a compound with the CAS number 239466-74-1. It is a mixture of diastereomers, primarily consisting of more than 90% of the active component. trans-R-138727 is recognized for its utility in the field of organic synthesis, making it a valuable asset for researchers and chemists working with various chemical reactions and processes.
Uses
Used in Pharmaceutical Industry:
Trans-R-138727 is used as an intermediate in the synthesis of pharmaceutical compounds, particularly those related to the development of novel drugs and therapies. Its role in organic synthesis allows for the creation of new molecules with potential medicinal properties, contributing to the advancement of pharmaceutical research and drug development.
Used in Chemical Research:
In the field of chemical research, trans-R-138727 serves as a valuable compound for studying various reaction mechanisms and exploring the potential of new chemical pathways. Its unique structure and properties make it an interesting subject for researchers looking to understand and manipulate chemical reactions for the synthesis of new compounds.
Used in Organic Synthesis:
Trans-R-138727 is used as a key component in organic synthesis processes, where it can be employed to create a wide range of chemical products. Its versatility in reacting with other molecules allows for the development of new materials and compounds with various applications, from pharmaceuticals to industrial chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 239466-74-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,9,4,6 and 6 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 239466-74:
(8*2)+(7*3)+(6*9)+(5*4)+(4*6)+(3*6)+(2*7)+(1*4)=171
171 % 10 = 1
So 239466-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H20FNO3S/c19-14-4-2-1-3-13(14)17(18(23)11-5-6-11)20-8-7-15(24)12(10-20)9-16(21)22/h1-4,9,11,15,17,24H,5-8,10H2,(H,21,22)/b12-9-