2428-31-1 Usage
Description
1-(3,4,5-Trimethoxybenzylidene)-1H-indene is a chemical compound with the molecular formula C24H24O3, derived from indene and featuring a benzylidene group with three methoxy substituents on the benzene ring. 1-(3,4,5-Trimethoxybenzylidene)-1H-indene has been investigated for its pharmaceutical and industrial potential, exhibiting anti-inflammatory and antitumor properties in preclinical studies. Additionally, it holds promise as a dye intermediate and a fragrance ingredient, though further research is necessary to fully comprehend its properties and possible applications.
Uses
Used in Pharmaceutical Applications:
1-(3,4,5-Trimethoxybenzylidene)-1H-indene is used as a pharmaceutical agent for its demonstrated anti-inflammatory and antitumor activities. Preclinical studies have shown its potential in treating various conditions and diseases, making it a candidate for further research and development in the medical field.
Used in Dye Industry:
1-(3,4,5-Trimethoxybenzylidene)-1H-indene is used as a dye intermediate due to its chemical structure and properties. Its potential in this industry lies in its ability to contribute to the creation of new and improved dyes for various applications.
Used in Fragrance Industry:
As a fragrance ingredient, 1-(3,4,5-Trimethoxybenzylidene)-1H-indene is utilized for its unique scent properties. Its incorporation into the fragrance industry could lead to the development of novel and distinct scents for various products.
Check Digit Verification of cas no
The CAS Registry Mumber 2428-31-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,2 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2428-31:
(6*2)+(5*4)+(4*2)+(3*8)+(2*3)+(1*1)=71
71 % 10 = 1
So 2428-31-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H18O3/c1-20-17-11-13(12-18(21-2)19(17)22-3)10-15-9-8-14-6-4-5-7-16(14)15/h4-12H,1-3H3/b15-10-
