243863-36-7 Usage
Description
2-(Difluoromethoxy)benzylamine is an organic compound with the molecular formula C8H8F2NO. It is a derivative of benzylamine, featuring a difluoromethoxy group at the 2nd position of the benzene ring. 2-(DIFLUOROMETHOXY)BENZYLAMINE is known for its unique chemical properties and reactivity, making it a versatile building block in the synthesis of various pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Industry:
2-(Difluoromethoxy)benzylamine is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique chemical structure allows it to be a key component in the development of new medications, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In addition to its pharmaceutical applications, 2-(difluoromethoxy)benzylamine is also utilized in chemical research. It serves as a valuable starting material for the synthesis of a wide range of organic compounds, including those with potential applications in materials science, agrochemicals, and other specialized fields.
Check Digit Verification of cas no
The CAS Registry Mumber 243863-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,3,8,6 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 243863-36:
(8*2)+(7*4)+(6*3)+(5*8)+(4*6)+(3*3)+(2*3)+(1*6)=147
147 % 10 = 7
So 243863-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9F2NO/c9-8(10)12-7-4-2-1-3-6(7)5-11/h1-4,8H,5,11H2
