2495-25-2 Usage
General Description
Tridecyl methacrylate is a chemical compound commonly used in the production of polymers and plastics. It is a methacrylate ester, meaning it is derived from methacrylic acid and tridecyl alcohol. This chemical is primarily used as a monomer in the synthesis of polymers and copolymers, imparting properties such as flexibility, adhesion, and impact resistance to the final materials. Tridecyl methacrylate is also used as a reactive diluent in the formulation of adhesives, coatings, and sealants, where it can improve the flexibility and durability of the final products. Overall, tridecyl methacrylate plays a crucial role in the production of various industrial materials, contributing to their performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 2495-25-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,9 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2495-25:
(6*2)+(5*4)+(4*9)+(3*5)+(2*2)+(1*5)=92
92 % 10 = 2
So 2495-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H32O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-19-17(18)16(2)3/h2,4-15H2,1,3H3
