264903-53-9 Usage
General Description
D-Styrylalanine is a synthetic amino acid derivative often used in chemical and pharmaceutical research. As an isomer of the naturally occurring amino acid L-phenylalanine, D-styrylalanine showcases unique bioactive and biomimetic properties. It's notable for being a key component in the synthesis of certain types of peptides and proteins, including certain enzymes and antibiotics. It is typically used as an intermediate in the manufacture of more complex chemical compounds. As it is rare in nature, it is usually produced in a laboratory setting.
Check Digit Verification of cas no
The CAS Registry Mumber 264903-53-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,4,9,0 and 3 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 264903-53:
(8*2)+(7*6)+(6*4)+(5*9)+(4*0)+(3*3)+(2*5)+(1*3)=149
149 % 10 = 9
So 264903-53-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-9(11(13)14)12-8-7-10-5-3-2-4-6-10/h2-9,12H,1H3,(H,13,14)/b8-7+/t9-/m1/s1
