269396-73-8 Usage
Description
Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid is a specialty chemical compound used in scientific research, particularly in the field of chemistry. It features a fluorenylmethyloxycarbonyl (Fmoc) protection group that shields amines during peptide synthesis, and an (R)-3-amino-4-(4-iodo-phenyl)-butyric acid configuration, which includes an iodine atom attached to a phenyl and butyric acid group. This unique structure allows for its use in the synthesis of various peptides and organic compounds, with the iodine atom facilitating specific chemical reactions.
Uses
Used in Peptide Synthesis:
Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid is used as a building block in peptide synthesis for the incorporation of specific amino acid sequences into peptides. The presence of the Fmoc group ensures that the amine function is protected during the synthesis process, preventing unwanted side reactions and facilitating the stepwise assembly of peptide chains.
Used in Organic Synthesis:
In the field of organic synthesis, Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid is used as a versatile intermediate for the preparation of various organic compounds. The iodine atom in the molecule can participate in a range of chemical reactions, such as cross-coupling reactions, which enable the formation of new carbon-carbon or carbon-heteroatom bonds, expanding the synthetic potential of this compound.
Used in Pharmaceutical Industry:
Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid is used as a key intermediate in the synthesis of pharmaceutical compounds, particularly those targeting specific biological receptors or enzymes. The unique structure of this compound allows for the development of novel drug candidates with potential therapeutic applications in various diseases and conditions.
Used in Chemical Research:
In the realm of chemical research, Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid serves as a valuable tool for studying the reactivity and selectivity of various chemical reactions. The presence of the iodine atom and the Fmoc-protected amine group allows researchers to explore the influence of these functional groups on reaction outcomes and develop new synthetic methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 269396-73-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 269396-73:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*6)+(2*7)+(1*3)=198
198 % 10 = 8
So 269396-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C25H22INO4/c26-17-11-9-16(10-12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m1/s1