269398-86-9 Usage
General Description
FMOC-(R)-3-amino-4-(4-methyl-phenyl)-butyric acid is a chemical compound with the formula C21H23NO4. It is a derivative of the amino acid leucine and is commonly used in the field of organic chemistry as a building block for the synthesis of various peptides and other organic molecules. The compound features a 3-amino-4-(4-methyl-phenyl)-butyric acid moiety, with an FMOC (9-fluorenylmethyloxycarbonyl) protecting group attached to the alpha-amino group. The FMOC group serves to protect the amine functionality during chemical reactions and can be easily removed under mild conditions, making it a versatile tool in organic synthesis. Additionally, the compound's structural flexibility and substituent properties make it a valuable starting material for the construction of diverse chemical structures.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 269398-86:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*8)+(1*6)=209
209 % 10 = 9
So 269398-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H25NO4/c1-17-10-12-18(13-11-17)14-19(15-25(28)29)27-26(30)31-16-24-22-8-4-2-6-20(22)21-7-3-5-9-23(21)24/h2-13,19,24H,14-16H2,1H3,(H,27,30)(H,28,29)/t19-/m1/s1