26963-43-9 Usage
General Description
4-Methyl-6-(2-thienyl)-2-pyrimidinamine is a chemical compound with the molecular formula C9H8N4S. It is a pyrimidine derivative with a 4-methyl group, a 2-thienyl group, and an amine group. 4-METHYL-6-(2-THIENYL)-2-PYRIMIDINAMINE has the potential to be used in the pharmaceutical industry as a building block for new drug development due to its unique chemical structure and potential biological activity. Its specific uses and properties are subject to ongoing research and discovery, but it holds promise for applications in the fields of medicine and chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 26963-43-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,9,6 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 26963-43:
(7*2)+(6*6)+(5*9)+(4*6)+(3*3)+(2*4)+(1*3)=139
139 % 10 = 9
So 26963-43-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3S/c1-6-5-7(12-9(10)11-6)8-3-2-4-13-8/h2-5H,1H3,(H2,10,11,12)
