270065-88-8 Usage
General Description
"(S)-3-Amino-4-(4-cyanophenyl)butanoic acid hydrochloride is a chemical compound often used in pharmaceutical research due to its potential therapeutic properties. This heterogeneous compound contains multiple functional groups which includes an amino group, a cyanophenyl group, a butanoic acid group, and a hydrochloride group. The compound's structure, particularly the presence of these functional groups, gives it unique chemical properties including solubility in water due to the hydrochloride group and potential reactivity with other substances due to the amino and cyanophenyl groups. Its potential in drug development makes it an important chemical in pharmacology and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 270065-88-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 270065-88:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*5)+(2*8)+(1*8)=128
128 % 10 = 8
So 270065-88-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2.ClH/c12-7-9-3-1-8(2-4-9)5-10(13)6-11(14)15;/h1-4,10H,5-6,13H2,(H,14,15);1H/t10-;/m0./s1