27187-01-5 Usage
Description
4-Chloro-2-Methylisoquinolin-1(2H)-one is a chemical compound with the molecular formula C10H8ClNO, belonging to the class of isoquinolinone compounds. It is characterized by a chloro and methyl group attached to the isoquinolinone core structure, which gives it unique properties and potential applications in various fields.
Uses
Used in Medicinal Chemistry:
4-Chloro-2-Methylisoquinolin-1(2H)-one is used as a pharmaceutical candidate for the development of new drugs due to its interesting biological properties. It has been studied for its potential applications in the field of medicinal chemistry, particularly in the development of pharmaceuticals.
Used in Chemical Research:
4-Chloro-2-Methylisoquinolin-1(2H)-one is used as a building block for the synthesis of other organic compounds, contributing to the advancement of chemical research and the discovery of new compounds with potential applications.
Used in Pharmaceutical Development:
4-Chloro-2-Methylisoquinolin-1(2H)-one is used as a key intermediate in the synthesis of various pharmaceuticals, owing to its unique structure and potential biological activity. Its presence in the development pipeline highlights its importance in creating new therapeutic agents.
Used in Synthesis of Organic Compounds:
4-Chloro-2-Methylisoquinolin-1(2H)-one is used as a starting material for the synthesis of other organic compounds, expanding the scope of chemical research and the development of novel molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 27187-01-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,8 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 27187-01:
(7*2)+(6*7)+(5*1)+(4*8)+(3*7)+(2*0)+(1*1)=115
115 % 10 = 5
So 27187-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClNO/c1-12-6-9(11)7-4-2-3-5-8(7)10(12)13/h2-6H,1H3
27187-01-5Relevant articles and documents
Harnessing selective PET and EnT catalysis by chlorophyll to synthesizeN-alkylated quinoline-2(1H)-ones, isoquinoline-1(2H)-ones and 1,2,4-trioxanes
Banu, Saira,Singh, Kuldeep,Tyagi, Shaifali,Yadav, Anjali,Yadav, Prem P.
supporting information, p. 9433 - 9438 (2021/11/17)
Photocatalytic syntheses of quinoline-2(1H)-ones, isoquinoline-1(2H)-ones and 1,2,4-trioxanes were achieved by selective photo-induced electron transfer (PET) and energy transfer (EnT), respectively, by chlorophyll under visible light irradiation. Quinoli