27280-85-9 Usage
General Description
2-Oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) is a chemical combination of 2-oxoglutaric acid and 5-hydroxy-6-methylpyridine-3,4-dimethanol in a 1:1 ratio. 2-oxoglutaric acid, also known as alpha-ketoglutaric acid, is an important intermediate in the citric acid cycle and plays a key role in cellular energy production. 5-hydroxy-6-methylpyridine-3,4-dimethanol is a derivative of pyridine, and may have potential medicinal or pharmaceutical applications. The combination of these two compounds may have unique properties and potential uses in various industries, including pharmaceuticals, healthcare, and research.
Check Digit Verification of cas no
The CAS Registry Mumber 27280-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,8 and 0 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27280-85:
(7*2)+(6*7)+(5*2)+(4*8)+(3*0)+(2*8)+(1*5)=119
119 % 10 = 9
So 27280-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3.C5H6O5/c1-5-8(12)7(4-11)6(3-10)2-9-5;6-3(5(9)10)1-2-4(7)8/h2,10-12H,3-4H2,1H3;1-2H2,(H,7,8)(H,9,10)