2783-73-5 Usage
Description
3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide is a complex organic chemical compound characterized by its molecular formula C23H20IN3S2. It is a benzothiazolium iodide derivative featuring a unique structure with multiple methyl and benzothiazolium groups, which may contribute to its potential reactivity and applications in chemical research and organic synthesis.
Uses
Used in Organic Synthesis:
3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide is used as a synthetic intermediate for the preparation of various organic compounds due to its unique structural features and potential reactivity.
Used in Chemical Research:
In the field of chemical research, 3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide serves as a valuable compound for studying its properties and exploring its potential applications. Further characterization and investigation in a laboratory setting are required to fully understand its capabilities and utility.
Note: Since the provided materials do not specify particular industries or detailed applications, the uses listed are general and based on the compound's potential properties and reactivity. Further research would be necessary to identify specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2783-73-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,8 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2783-73:
(6*2)+(5*7)+(4*8)+(3*3)+(2*7)+(1*3)=105
105 % 10 = 5
So 2783-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H19N2S2.HI/c1-14(12-19-21(2)15-8-4-6-10-17(15)23-19)13-20-22(3)16-9-5-7-11-18(16)24-20;/h4-13H,1-3H3;1H/q+1;/p-1