28495-88-7 Usage
Description
1-METHYL-5-NITROURACIL is a chemical compound that consists of a uracil molecule with a methyl group and a nitro group attached to it. It is a white to off-white powder that is slightly soluble in water and ethanol. 1-METHYL-5-NITROURACIL is known for its pharmacological properties, particularly its ability to inhibit the enzyme dihydroorotate dehydrogenase, which is involved in the de novo pyrimidine biosynthesis pathway. It has been studied for its potential as an antitumor and antiviral agent, as well as a modulator of immune responses. Additionally, 1-methyl-5-nitro uracil has been identified as a potential precursor for the synthesis of other pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
1-METHYL-5-NITROURACIL is used as an active pharmaceutical ingredient for its potential antitumor and antiviral properties. Its ability to inhibit the enzyme dihydroorotate dehydrogenase makes it a promising candidate for the development of new drugs targeting cancer and viral infections.
Used in Drug Synthesis:
1-METHYL-5-NITROURACIL is used as a precursor in the synthesis of other pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications in various medical fields.
Used in Immunomodulation:
1-METHYL-5-NITROURACIL is used as an immunomodulator to modulate immune responses. Its potential to influence the immune system makes it a candidate for the development of drugs targeting autoimmune diseases and other conditions where immune modulation is required.
Check Digit Verification of cas no
The CAS Registry Mumber 28495-88-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,4,9 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 28495-88:
(7*2)+(6*8)+(5*4)+(4*9)+(3*5)+(2*8)+(1*8)=157
157 % 10 = 7
So 28495-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O4/c1-7-2-3(8(11)12)4(9)6-5(7)10/h2H,1H3,(H,6,9,10)