286367-59-7 Usage
Description
OXALIC ACID (1,2-13C2) is a labeled analog of Oxalic Acid (O845120), which is an impurity of oxaliplatin, a coordination complex utilized in cancer chemotherapy. OXALIC ACID (1,2-13C2) is characterized by its unique isotopic labeling, which allows for the study of its interactions and behavior in various applications. It serves as a reducing agent and its conjugate base, oxalate (C2O42-), is recognized for its chelating properties, making it effective in binding metal cations.
Uses
Used in Cancer Chemotherapy:
OXALIC ACID (1,2-13C2) is used as an impurity in the coordination complex oxaliplatin, which is employed as a chemotherapeutic agent. OXALIC ACID (1,2-13C2) plays a role in the treatment of various types of cancer, including colorectal cancer, by interacting with and damaging cancer cells.
Used as a Reducing Agent:
OXALIC ACID (1,2-13C2) is utilized as a reducing agent in various chemical reactions. Its ability to donate electrons allows it to facilitate the reduction of other compounds, making it a valuable component in the synthesis and processing of certain chemicals.
Used as a Chelating Agent in Metal Cation Binding:
The conjugate base of OXALIC ACID (1,2-13C2), known as oxalate (C2O42-), is used as a chelating agent for metal cations. Its ability to form stable complexes with metal ions makes it an essential component in various industrial applications, such as water treatment, where it can help remove heavy metals from contaminated water sources.
Used in Research and Development:
Due to its isotopic labeling, OXALIC ACID (1,2-13C2) is used in research and development to study the behavior and interactions of oxalic acid and its derivatives in different chemical and biological systems. This information can be valuable for understanding the mechanisms of action and potential applications of oxalic acid and related compounds in various fields, including medicine, agriculture, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 286367-59-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,6,3,6 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 286367-59:
(8*2)+(7*8)+(6*6)+(5*3)+(4*6)+(3*7)+(2*5)+(1*9)=187
187 % 10 = 7
So 286367-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C2H2O4.2H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H2/i1+1,2+1;;