29241-64-3 Usage
General Description
5,6-Dibromopyridine-3-carboxylic acid is a chemical compound known for its use in the synthesis of pharmaceuticals and agrochemicals. It is a derivative of pyridine, containing two bromine atoms at positions 5 and 6, as well as a carboxylic acid group at position 3. 5,6-DIBROMOPYRIDINE-3-CARBOXYLIC ACID has been studied for its potential as a building block in the development of new drugs and pesticides, as well as for its biological activities. Its unique structure and potential applications make it a valuable chemical for research and development in the pharmaceutical and agricultural industries.
Check Digit Verification of cas no
The CAS Registry Mumber 29241-64-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,2,4 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 29241-64:
(7*2)+(6*9)+(5*2)+(4*4)+(3*1)+(2*6)+(1*4)=113
113 % 10 = 3
So 29241-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)
