29329-88-2 Usage
General Description
1,3-diethyl-2-[2-(1-methyl-2-phenyl-1H-indol-3-yl)vinyl]-1H-imidazo[4,5-b]quinoxalinium toluene-p-sulphonate is a complex chemical compound which belongs to the larger group of molecules characterized by imidazoquinoxaline structure. Its extensive systematic name indicates the presence of multiple functional groups such as an indolyl group, imidazole ring and a quinoxalinium ring, among others. The suffix 'toluene-p-sulphonate' suggests it's in the form of a salt, with the toluene-p-sulphonate acting as the counter ion. Its exact properties, uses or implications in various fields like medicine or material science would require specific examination and study due to its complex structure.
Check Digit Verification of cas no
The CAS Registry Mumber 29329-88-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,3,2 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29329-88:
(7*2)+(6*9)+(5*3)+(4*2)+(3*9)+(2*8)+(1*8)=142
142 % 10 = 2
So 29329-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C30H29N5.C7H8O3S/c1-4-34-27(35(5-2)30-29(34)31-24-16-10-11-17-25(24)32-30)20-19-23-22-15-9-12-18-26(22)33(3)28(23)21-13-7-6-8-14-21;1-6-2-4-7(5-3-6)11(8,9)10/h6-20,27H,4-5H2,1-3H3;2-5H,1H3,(H,8,9,10)/p-1/b20-19+;