29682-53-9 Usage
General Description
5-Methyl-1,2,3-thiadiazole-4-carboxylic acid ethyl ester is a chemical compound with the molecular formula C6H7N3O2S. It is an ethyl ester derivative of 5-methyl-1,2,3-thiadiazole-4-carboxylic acid and is commonly used in organic synthesis and medicinal chemistry. 5-Methyl-1,2,3-thiadiazole-4-carboxylic acid ethyl ester has potential applications in the development of pharmaceuticals and agrochemicals due to its biological and pharmacological properties. It may also be used as a building block in the synthesis of various heterocyclic compounds. Additionally, it has been studied for its antimicrobial and anti-inflammatory activities, making it a valuable compound for pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 29682-53-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,8 and 2 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 29682-53:
(7*2)+(6*9)+(5*6)+(4*8)+(3*2)+(2*5)+(1*3)=149
149 % 10 = 9
So 29682-53-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2S/c1-3-10-6(9)5-4(2)11-8-7-5/h3H2,1-2H3