29703-01-3 Usage
Description
Cesium Bicarbonate, also known as Cesium Hydrogen Carbonate, is a rhomb white powder with unique chemical properties. It is a compound of cesium, hydrogen, carbon, and oxygen, and is commonly used in various industries due to its distinct characteristics.
Uses
Used in Pharmaceutical Industry:
Cesium Bicarbonate is used as a pharmaceutical intermediate for the development and production of various medications. Its unique chemical properties make it a valuable component in the synthesis of pharmaceutical compounds.
Used in Chemical Industry:
Cesium Bicarbonate is also utilized in the chemical industry for various applications, such as a buffering agent or a precursor in the synthesis of other cesium-based compounds. Its ability to neutralize acidic substances and its stability contribute to its widespread use in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 29703-01-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,7,0 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 29703-01:
(7*2)+(6*9)+(5*7)+(4*0)+(3*3)+(2*0)+(1*1)=113
113 % 10 = 3
So 29703-01-3 is a valid CAS Registry Number.
InChI:InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);
