29864-18-4 Usage
Chemical class
Imidazole-based organic compound
Structural features
Multiple phenyl and ethoxy groups
Potential applications
Pharmacology and medicinal chemistry
Areas of interest
Drug discovery and development
Investigation requirements
Dedicated studies and experiments to determine precise properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 29864-18-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,8,6 and 4 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29864-18:
(7*2)+(6*9)+(5*8)+(4*6)+(3*4)+(2*1)+(1*8)=154
154 % 10 = 4
So 29864-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C46H38N4O2/c1-3-51-39-31-19-17-29-37(39)45-47-43(35-25-13-7-14-26-35)44(36-27-15-8-16-28-36)50(45)46(38-30-18-20-32-40(38)52-4-2)48-41(33-21-9-5-10-22-33)42(49-46)34-23-11-6-12-24-34/h5-32H,3-4H2,1-2H3