30077-58-8 Usage
General Description
2,4-Diamino-5-(3,4-dichlorobenzyl)pyrimidine is a chemical compound with the molecular formula C11H10Cl2N4. It is a pyrimidine derivative with two amino groups and a dichlorobenzyl group attached to the pyrimidine ring. 2,4-Diamino-5-(3,4-dichlorobenzyl)pyrimidine is used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It has potential applications in the development of antiviral and anticancer drugs due to its structural features. Additionally, it may also be used in research and development of new chemical compounds for various industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 30077-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,0,7 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 30077-58:
(7*3)+(6*0)+(5*0)+(4*7)+(3*7)+(2*5)+(1*8)=88
88 % 10 = 8
So 30077-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10Cl2N4/c12-8-2-1-6(4-9(8)13)3-7-5-16-11(15)17-10(7)14/h1-2,4-5H,3H2,(H4,14,15,16,17)