3042-00-0 Usage
General Description
(2-Benzimidazolylthio)acetic acid is a chemical compound that is commonly used in pharmaceutical research and drug development. It is classified as a thiazolidinedione derivative, which is a class of drugs known for their potential use in the treatment of diabetes and other metabolic disorders. The compound is a potent inhibitor of peroxisome proliferator-activated receptor gamma (PPARγ), a nuclear receptor that plays a key role in the regulation of glucose and lipid metabolism. This makes (2-Benzimidazolylthio)acetic acid a promising candidate for the development of new medications for managing diabetes and related metabolic conditions. Additionally, it may have potential applications in research related to cancer, inflammation, and neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 3042-00-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,4 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3042-00:
(6*3)+(5*0)+(4*4)+(3*2)+(2*0)+(1*0)=40
40 % 10 = 0
So 3042-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2S/c12-8(13)5-14-9-10-6-3-1-2-4-7(6)11-9/h1-4H,5H2,(H,10,11)(H,12,13)/p-1
