304655-78-5 Usage
Description
3-AMINO-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID HEMIHYDRATE, also known as AmTAZAc, is an organic compound that serves as a building block in the synthesis of various materials. It is characterized by its unique chemical structure, which includes a triazole ring and a carboxylic acid group, making it a versatile compound for different applications.
Uses
Used in Chemical Synthesis:
3-AMINO-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID HEMIHYDRATE is used as a chemical intermediate for the synthesis of new three-dimensional metal-organic frameworks (MOFs), specifically [ZnF(AmTAZ)] solvents. Its unique structure allows for the creation of complex and functional materials with potential applications in various fields.
Used in Material Science:
In the Material Science industry, 3-AMINO-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID HEMIHYDRATE is used as a precursor for the development of advanced materials with tailored properties. The synthesized MOFs, such as [ZnF(AmTAZ)], can exhibit unique characteristics, making them suitable for applications in gas storage, catalysis, and sensing.
Used in Pharmaceutical Research:
3-AMINO-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID HEMIHYDRATE may also be utilized in the pharmaceutical industry as a starting material for the development of new drugs. Its chemical structure can be modified to create potential therapeutic agents, targeting various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 304655-78-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,4,6,5 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 304655-78:
(8*3)+(7*0)+(6*4)+(5*6)+(4*5)+(3*5)+(2*7)+(1*8)=135
135 % 10 = 5
So 304655-78-5 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N4O2.H2O/c4-3-5-1(2(8)9)6-7-3;/h(H,8,9)(H3,4,5,6,7);1H2