3065-23-4 Usage
General Description
2,4,5-trichlorophenyl N-[(benzyloxy)carbonyl]-L-valinate is a chemical compound containing three chlorine atoms, a phenyl group, and a valinate group. The chemical also includes a benzyloxy carbonyl group. It is commonly used as a building block in the synthesis of various pharmaceuticals and agrochemicals. 2,4,5-trichlorophenyl N-[(benzyloxy)carbonyl]-L-valinate has potential applications in the development of new drugs and pesticide formulations due to its unique structure and properties. Additionally, it may also be utilized in research and development in the fields of organic chemistry and medicinal chemistry. Overall, 2,4,5-trichlorophenyl N-[(benzyloxy)carbonyl]-L-valinate is a versatile chemical with a wide range of potential applications in various industries and research fields.
Check Digit Verification of cas no
The CAS Registry Mumber 3065-23-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,6 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3065-23:
(6*3)+(5*0)+(4*6)+(3*5)+(2*2)+(1*3)=64
64 % 10 = 4
So 3065-23-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H18Cl3NO4/c1-11(2)17(23-19(25)26-10-12-6-4-3-5-7-12)18(24)27-16-9-14(21)13(20)8-15(16)22/h3-9,11,17H,10H2,1-2H3,(H,23,25)