306935-48-8 Usage
General Description
4-(allyl)-5-(quinol-6-yl)-1,2,4-triazole-3-thiol is a chemical compound that contains a triazole ring with a thiol group and allyl and quinol-6-yl substituents. It has potential applications in medicinal chemistry and drug design due to its structural features and potential biological activities. The allyl group is a common functional group found in organic compounds that can participate in various chemical reactions, while the quinol-6-yl group is a heterocyclic ring system with potential pharmacological properties. The presence of the triazole ring and thiol group in the structure also offers opportunities for further chemical modifications to explore its potential as a drug candidate or as a chemical tool in research.
Check Digit Verification of cas no
The CAS Registry Mumber 306935-48-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 306935-48:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*5)+(2*4)+(1*8)=148
148 % 10 = 8
So 306935-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N4S/c1-2-8-18-13(16-17-14(18)19)11-5-6-12-10(9-11)4-3-7-15-12/h2-7,9H,1,8H2,(H,17,19)