307531-80-2 Usage
Description
2,6-DICHLOROBENZYLZINC CHLORIDE is an organometallic compound that features a benzyl group with two chlorine atoms at the 2nd and 6th positions, bonded to a zinc chloride. It is a reagent used in chemical synthesis and has specific applications in the production of various organic compounds.
Uses
Used in Chemical Synthesis:
2,6-DICHLOROBENZYLZINC CHLORIDE is used as a substrate for the palladium-catalyzed synthesis of 1-phenyl-2,5-hexanedione derivatives using methyl vinyl ketone and carbon monoxide. This application is significant in the production of complex organic molecules that can be utilized in various industries, such as pharmaceuticals, agrochemicals, and materials science.
In the Pharmaceutical Industry:
2,6-DICHLOROBENZYLZINC CHLORIDE is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique structure allows for the creation of molecules with specific biological activities, potentially leading to the discovery of novel drugs with improved efficacy and safety profiles.
In the Agrochemical Industry:
2,6-DICHLOROBENZYLZINC CHLORIDE is used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, ultimately contributing to increased crop yields and food security.
In the Materials Science Industry:
2,6-DICHLOROBENZYLZINC CHLORIDE is used in the development of advanced materials with specific properties, such as improved strength, durability, or conductivity. These materials can be applied in various fields, including electronics, aerospace, and automotive industries, where high-performance materials are crucial for the functionality and efficiency of the products.
Check Digit Verification of cas no
The CAS Registry Mumber 307531-80-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,7,5,3 and 1 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 307531-80:
(8*3)+(7*0)+(6*7)+(5*5)+(4*3)+(3*1)+(2*8)+(1*0)=122
122 % 10 = 2
So 307531-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2.ClH.Zn/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl2Zn.ClH/c8-6-2-1-3-7(9)5(6)4-10;/h1-3H,4H2;1H/q+1;/p-1
