30806-09-8 Usage
General Description
H-LEU-BETA-ALA-OH is a chemical compound that consists of the amino acids leucine and beta-alanine. Leucine is an essential amino acid that plays a crucial role in protein synthesis and muscle repair. It also regulates blood sugar levels and provides energy to muscles. Beta-alanine is a non-essential amino acid that helps in the production of carnosine, a dipeptide that acts as a buffer against the build-up of acid in muscles during intense exercise. The combination of these two amino acids in H-LEU-BETA-ALA-OH may have potential benefits for muscle growth, endurance, and athletic performance.
Check Digit Verification of cas no
The CAS Registry Mumber 30806-09-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,8,0 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 30806-09:
(7*3)+(6*0)+(5*8)+(4*0)+(3*6)+(2*0)+(1*9)=88
88 % 10 = 8
So 30806-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O3/c1-6(2)5-7(10)9(14)11-4-3-8(12)13/h6-7H,3-5,10H2,1-2H3,(H,11,14)(H,12,13)
30806-09-8Relevant articles and documents
DPP4 INHIBITOR AND PHARMACEUTICAL APPLICATION THEREOF
-
Page/Page column 8-9, (2008/06/13)
The present invention provides a Dpp4 inhibitor which comprises a leucine derivative of the following formula (1) or a methionine derivative of the following formula (2): wherein each R1 and R3 represents a hydrogen atom (H) and an L-amino acid residue; R2 represents a hydroxyl group (OH), alkoxy group having 1 to 6 carbon atoms, amino group (NH2), alkylamino group having 1 to 6 carbon atoms, glycine residue, β-alanine residue, L-amino acid (except for proline, alanine and phenylalanine) residue or L-amino-acid amide (except for proline amide, alanine amide and phenylalanine amide) residue; and R4 represents a hydroxyl group (OH), alkoxy group having 1 to 6 carbon atoms, amino group (NH2), alkylamino group having 1 to 6 carbon atoms, glycine residue, β-alanine residue, L-amino acid (except for proline and alanine) residue or L-amino-acid amide (except for proline amide and alanine amide) residue. These derivatives also act as autophagy regulators.
