312517-86-5 Usage
General Description
4-(Furan-2-ylmethylsulfanylmethyl)-benzoic acid is a chemical compound that belongs to the class of benzoic acids. It consists of a benzoic acid group, which is a carboxylic acid, attached to a benzene ring and a sulfur-containing furan group. 4-(FURAN-2-YLMETHYLSULFANYLMETHYL)-BENZOIC ACID has potential applications in the pharmaceutical industry, particularly in the development of new drugs or medications. It may also be used in research and development for its unique chemical properties. Additionally, its structure and properties make it of interest to chemists and researchers studying organic chemistry and molecular interactions. Overall, 4-(Furan-2-ylmethylsulfanylmethyl)-benzoic acid has potential as a versatile compound with various potential applications in different fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 312517-86-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,5,1 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 312517-86:
(8*3)+(7*1)+(6*2)+(5*5)+(4*1)+(3*7)+(2*8)+(1*6)=115
115 % 10 = 5
So 312517-86-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12O3S/c14-13(15)11-5-3-10(4-6-11)8-17-9-12-2-1-7-16-12/h1-7H,8-9H2,(H,14,15)/p-1
