32089-70-6 Usage
Carbanilate derivative
A derivative of carbanilates, which are a class of organic compounds known for their various applications, including as pharmaceuticals and agrochemicals.
Amino group (-NH2)
A functional group present in the compound that consists of a nitrogen atom bonded to two hydrogen atoms, contributing to its reactivity and potential applications.
Ethyl group (-C2H5)
An alkyl group consisting of two carbon atoms and five hydrogen atoms, which adds to the complexity of the compound's structure and properties.
Dicyanovinyl substituent (-NC≡C-)
A functional group containing two cyano groups (-C≡N) bonded to a vinyl carbon, which may contribute to the compound's electronic properties and potential applications.
Methyl group (-CH3)
A small alkyl group consisting of one carbon atom and three hydrogen atoms, which can influence the compound's steric properties and reactivity.
Phenoxymethyl group (-OCH2C6H5)
A group consisting of a phenyl ring (C6H5) attached to a methylene (-CH2-), which can contribute to the compound's lipophilicity and interactions with other molecules.
Potential applications in pharmaceuticals and materials science
Due to its unique structure and properties, the compound may have various applications in fields such as drug development and material design.
Need for further research and testing
To fully understand the potential uses and effects of this chemical compound, additional research and testing are necessary to explore its properties, reactivity, and interactions with other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 32089-70-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,0,8 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 32089-70:
(7*3)+(6*2)+(5*0)+(4*8)+(3*9)+(2*7)+(1*0)=106
106 % 10 = 6
So 32089-70-6 is a valid CAS Registry Number.
InChI:InChI=1/C29H28N4O3/c1-3-33(26-15-14-24(22(2)16-26)17-23(18-30)19-31)20-28(21-35-27-12-8-5-9-13-27)36-29(34)32-25-10-6-4-7-11-25/h4-17,28H,3,20-21H2,1-2H3,(H,32,34)