32178-39-5 Usage
General Description
2,5-Diethoxy-4-(4-morpholinyl)benzenediazonium sulfate is a diazonium salt compound that contains a diazonium group attached to a benzene ring combined with diethoxy and morpholinyl substituents. 2,5-Diethoxy-4-(4-morpholinyl)benzenediazonium sulfate is commonly used in organic synthesis to introduce diazo functionality into various organic molecules. The morpholinyl group in the compound imparts basic properties, making it useful in the preparation of organic dyes and other chemical products. Additionally, its diazonium functionality allows it to be used as a precursor in the synthesis of various azo compounds, which are important intermediates in the production of pigments and dyes. Overall, 2,5-Diethoxy-4-(4-morpholinyl)benzenediazonium sulfate is a versatile chemical that has various applications in the field of organic synthesis and chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 32178-39-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,7 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32178-39:
(7*3)+(6*2)+(5*1)+(4*7)+(3*8)+(2*3)+(1*9)=105
105 % 10 = 5
So 32178-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N3O3.H2O4S/c1-3-19-13-10-12(17-5-7-18-8-6-17)14(20-4-2)9-11(13)16-15;1-5(2,3)4/h9-10H,3-8H2,1-2H3;(H2,1,2,3,4)/q+1;/p-2
