327027-21-4 Usage
General Description
1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose is a chemical compound belonging to the class of furanose derivatives. It is a derivative of D-xylofuranose and contains acetyl and benzoyl groups attached to specific positions on the sugar molecule. 1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose is often used in the synthesis of various carbohydrate-based molecules and has potential applications in medicinal chemistry, particularly in the development of new drugs and pharmaceuticals. Its unique structure and functional groups make it a valuable building block for the creation of diverse chemical compounds with potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 327027-21-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,7,0,2 and 7 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 327027-21:
(8*3)+(7*2)+(6*7)+(5*0)+(4*2)+(3*7)+(2*2)+(1*1)=114
114 % 10 = 4
So 327027-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H18O7/c1-10(17)21-13-8-15(22-11(2)18)23-14(13)9-20-16(19)12-6-4-3-5-7-12/h3-7,13-15H,8-9H2,1-2H3/t13-,14-,15?/m0/s1
