33311-76-1 Usage
Description
N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is a chemical compound with the molecular formula C21H15N3O6. It is a member of the isoindole derivatives class and is recognized for its potential applications in various fields due to its unique structural properties and functional groups. N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is often utilized as a reagent in organic chemistry and has garnered interest in pharmaceutical research, coordination chemistry, and the synthesis of complex organic compounds.
Uses
Used in Organic Chemistry:
N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is used as a reagent in organic chemistry for its ability to participate in various chemical reactions, facilitating the synthesis of a range of organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is used as a compound of interest for its potential to contribute to the development of new drugs. Its structural properties and functional groups make it a candidate for further exploration in medicinal chemistry.
Used as a Ligand in Coordination Chemistry:
N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide also serves as a ligand in coordination chemistry, where it can form complexes with metal ions. This role is significant for studying the properties and applications of metal-organic frameworks and other coordination compounds.
Used in the Synthesis of Complex Organic Compounds:
N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is utilized in the synthesis of complex organic compounds, where its unique structure and reactivity can be leveraged to create novel molecules with specific properties for various applications.
While the provided materials do not specify the exact applications or industries where N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is used, the above uses are inferred from its properties and typical applications of similar compounds in the fields of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 33311-76-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,1 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33311-76:
(7*3)+(6*3)+(5*3)+(4*1)+(3*1)+(2*7)+(1*6)=81
81 % 10 = 1
So 33311-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H15N3O6/c27-20(13-25-22(29)16-8-4-5-9-17(16)23(25)30)24-19-11-10-15(26(31)32)12-18(19)21(28)14-6-2-1-3-7-14/h1-12H,13H2,(H,24,27)