33446-84-3 Usage
General Description
1,1-dimethoxysilacyclobutane is a chemical compound with the molecular formula C5H12O2Si. It is a cyclic organosilicon compound that contains a four-membered ring with two oxygen atoms and a silicon atom. 1,1-dimethoxysilacyclobutane is commonly used in the field of organic and inorganic chemistry, as well as in materials science. It is often utilized as a precursor in the synthesis of other organosilicon compounds and is known for its ability to form strong silicon-oxygen bonds. Additionally, its unique structure and reactivity make it a valuable building block for the creation of advanced materials and polymers. Overall, 1,1-dimethoxysilacyclobutane plays a significant role in various fields of scientific research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 33446-84-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,4,4 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 33446-84:
(7*3)+(6*3)+(5*4)+(4*4)+(3*6)+(2*8)+(1*4)=113
113 % 10 = 3
So 33446-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H12O2Si/c1-6-8(7-2)4-3-5-8/h3-5H2,1-2H3
