33669-70-4 Usage
General Description
4,7-Dihydroxypteridine is a chemical compound that belongs to the class of pteridine derivatives. It is a colorless crystalline solid with the molecular formula C6H6N4O2. 4,7-Dihydroxypteridine is an intermediate in the biosynthesis of folate and pteridine compounds. It plays a crucial role in the production of tetrahydrobiopterin, a cofactor for enzymes involved in the synthesis of neurotransmitters and nitric oxide. Additionally, 4,7-Dihydroxypteridine has potential applications in the pharmaceutical industry as a precursor for the synthesis of pteridine-based drugs and dyes. Its chemical properties and biological significance make it an important target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 33669-70-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,6,6 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 33669-70:
(7*3)+(6*3)+(5*6)+(4*6)+(3*9)+(2*7)+(1*0)=134
134 % 10 = 4
So 33669-70-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-3-1-7-4-5(10-3)8-2-9-6(4)12/h1-2H,(H2,8,9,10,11,12)
