340319-91-7 Usage
General Description
1-Naphthalen-1-yl-5-oxo-pyrrolidine-3-carboxylic acid is a chemical compound with a unique structure consisting of a naphthalene ring attached to a pyrrolidine ring with a carboxylic acid group. 1-NAPHTHALEN-1-YL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID is used in various pharmaceutical applications due to its potential as a building block for the synthesis of complex molecules with biological activity. It can also act as a ligand in coordinating metal ions, making it useful in inorganic chemistry studies. Furthermore, its structure suggests potential for use in organic synthesis and as a starting material for the creation of new materials. The diverse functional groups present in this compound provide a wide range of potential applications in pharmaceutical, biochemical, and materials science research.
Check Digit Verification of cas no
The CAS Registry Mumber 340319-91-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,0,3,1 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 340319-91:
(8*3)+(7*4)+(6*0)+(5*3)+(4*1)+(3*9)+(2*9)+(1*1)=117
117 % 10 = 7
So 340319-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H13NO3/c17-14-8-11(15(18)19)9-16(14)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9H2,(H,18,19)/p-1/t11-/m1/s1
