34164-92-6 Usage
Description
(H-imidazo[1,2-a]pyridin-3-yl)methanamine hydrochloride is an organic compound with a unique chemical structure that features an imidazo[1,2-a]pyridine core and a hydrochloride group. It is known for its potential applications in the pharmaceutical industry, particularly in the development of novel therapeutic agents.
Uses
Used in Pharmaceutical Industry:
(H-imidazo[1,2-a]pyridin-3-yl)methanamine hydrochloride is used as a reagent for the preparation of benzocycloheptapyridine derivatives. These derivatives are known to be tyrosine kinase inhibitors, which play a crucial role in the treatment of various types of cancer.
Application Reason:
(H-imidazo[1,2-a]pyridin-3-yl)methanamine hydrochloride's ability to act as a reagent in the synthesis of tyrosine kinase inhibitors makes it a valuable asset in the development of targeted cancer therapies. Tyrosine kinases are enzymes that are often overactive in cancer cells, leading to uncontrolled cell growth and tumor formation. By inhibiting these enzymes, benzocycloheptapyridine derivatives can potentially slow down or stop the progression of cancer, offering a more effective treatment option for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 34164-92-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,1,6 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34164-92:
(7*3)+(6*4)+(5*1)+(4*6)+(3*4)+(2*9)+(1*2)=106
106 % 10 = 6
So 34164-92-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3.ClH/c9-5-7-6-10-8-3-1-2-4-11(7)8;/h1-4,6H,5,9H2;1H
