347320-62-1 Usage
Explanation
Different sources of media describe the Explanation of 347320-62-1 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 19 carbon (C) atoms, 22 hydrogen (H) atoms, 2 nitrogen (N) atoms, and 2 oxygen (O) atoms.
2. The compound's structure consists of two heterocyclic rings, a piperidine ring (a six-membered ring with one nitrogen atom) and an indole ring (a bicyclic structure with a benzene ring fused to a pyrrole ring).
3. Benzodiazepine Receptor Ligand
3. The compound interacts with benzodiazepine receptors, which are a type of protein found in the central nervous system. These receptors play a role in the regulation of various physiological processes, including anxiety and sedation.
4. The compound serves as a precursor or intermediate in the chemical synthesis of other pharmaceutical drugs, specifically telaprevir, which is used to treat hepatitis C.
5. Pharmacological and Biological Properties
5. The compound has potential pharmacological and biological properties, which means it may have effects on living organisms and could be used for therapeutic purposes.
Chemical Structure
Contains a piperidine ring and an indole ring
Intermediate in Synthesis
Used in the synthesis of pharmaceutical drugs like telaprevir
Check Digit Verification of cas no
The CAS Registry Mumber 347320-62-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,7,3,2 and 0 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 347320-62:
(8*3)+(7*4)+(6*7)+(5*3)+(4*2)+(3*0)+(2*6)+(1*2)=131
131 % 10 = 1
So 347320-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N2O2/c1-13-6-8-18(9-7-13)17(21)11-19-10-14(12-20)15-4-2-3-5-16(15)19/h2-5,10,12-13H,6-9,11H2,1H3
