34970-18-8 Usage
General Description
3,3-Dimethylcyclobutanecarboxylic acid is a organic chemical compound with the molecular formula C7H10O2. It is a carboxylic acid consisting of a cyclobutane ring with two methyl groups and a carboxylic acid group attached. 3,3-DIMETHYLCYCLOBUTANECARBOXYLIC ACID is used as a building block in organic synthesis and pharmaceutical research. It has potential applications in the development of pharmaceutical drugs and other bioactive compounds due to its unique structure and properties. 3,3-Dimethylcyclobutanecarboxylic acid is also considered a valuable intermediate in the production of various organic compounds and has potential application in the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 34970-18-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,7 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 34970-18:
(7*3)+(6*4)+(5*9)+(4*7)+(3*0)+(2*1)+(1*8)=128
128 % 10 = 8
So 34970-18-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O2/c1-7(2)3-5(4-7)6(8)9/h5H,3-4H2,1-2H3,(H,8,9)
