3561-48-6 Usage
General Description
Z-GLY-MET-OH, also known as N-carbobenzoxy-glycyl-L-methionine, is a chemical compound commonly used as a building block in peptide synthesis. It is an amino acid derivative with a benzyloxycarbonyl (Z) protecting group attached to the glycine amino group and a methionine residue. Z-GLY-MET-OH is often employed in the production of biologically active peptides, pharmaceuticals, and research applications. It serves as a versatile starting material for the preparation of various peptide derivatives and can be used in the synthesis of complex peptide sequences through solid-phase peptide synthesis or other methods. Overall, Z-GLY-MET-OH plays a crucial role in peptide chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 3561-48-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,6 and 1 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3561-48:
(6*3)+(5*5)+(4*6)+(3*1)+(2*4)+(1*8)=86
86 % 10 = 6
So 3561-48-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O5S/c1-23-8-7-12(14(19)20)17-13(18)9-16-15(21)22-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,16,21)(H,17,18)(H,19,20)