3561-57-7 Usage
General Description
H-ASN-P-NITROBENZYL ESTER HBR is a chemical compound that consists of an asparagine residue with a nitrobenzyl ester attached. It is commonly used in biochemistry and molecular biology research as a reagent for modifying proteins and peptides. H-ASN-P-NITROBENZYL ESTER HBR can be utilized in the synthesis of peptides and proteins, as well as in the study of protein structure and function. Additionally, its unique properties make it a valuable tool in drug discovery and development, particularly in the design and synthesis of potential pharmaceutical compounds. Overall, H-ASN-P-NITROBENZYL ESTER HBR plays a crucial role in various scientific and medical applications due to its ability to selectively modify and study biological molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 3561-57-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,6 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3561-57:
(6*3)+(5*5)+(4*6)+(3*1)+(2*5)+(1*7)=87
87 % 10 = 7
So 3561-57-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O5/c12-9(5-10(13)15)11(16)19-6-7-1-3-8(4-2-7)14(17)18/h1-4,9H,5-6,12H2,(H2,13,15)
