35845-23-9 Usage
General Description
2-(7-chloro-1H-indazol-3-yl)acetic acid is a chemical compound with the molecular formula C10H7ClN2O2. It is a derivative of indazole with an additional acetic acid group. 2-(7-CHLORO-1H-INDAZOL-3-YL)ACETIC ACID is used in various research applications and pharmaceutical development as a potential drug candidate for the treatment of various diseases. Its chemical structure and properties make it a promising candidate for targeting specific biological pathways and potentially developing new therapeutic interventions. However, further research and testing are required to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 35845-23-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,8,4 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 35845-23:
(7*3)+(6*5)+(5*8)+(4*4)+(3*5)+(2*2)+(1*3)=129
129 % 10 = 9
So 35845-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c10-6-3-1-2-5-7(4-8(13)14)11-12-9(5)6/h1-3H,4H2,(H,11,12)(H,13,14)