35978-75-7 Usage
General Description
AC-ALA-PNA is a chemical compound that is used primarily in the field of peptide synthesis. It is a derivative of the amino acid alanine, and it contains a protective group known as AC. The PNA component refers to peptide nucleic acid, which is an artificial DNA mimic that can be used to bind to specific nucleotide sequences. AC-ALA-PNA is used as a building block for creating peptide nucleic acid complexes, and it is often employed in the development of molecular probes for biological research and diagnostic purposes. AC-ALA-PNA plays a crucial role in the synthesis of PNA-based biomolecules and has significant utility in the study of gene expression, genetic disorders, and other molecular biology applications.
Check Digit Verification of cas no
The CAS Registry Mumber 35978-75-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,7 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35978-75:
(7*3)+(6*5)+(5*9)+(4*7)+(3*8)+(2*7)+(1*5)=167
167 % 10 = 7
So 35978-75-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O4/c1-7(12-8(2)15)11(16)13-9-3-5-10(6-4-9)14(17)18/h3-7H,1-2H3,(H,12,15)(H,13,16)/t7-/m0/s1
