36297-22-0 Usage
General Description
(E)-2-Bromo-2-butenoic acid is a chemical compound with the molecular formula C4H5BrO2. It is a colorless liquid with a pungent odor and is highly soluble in water. (E)-2-Bromo-2-butenoic acid is primarily used in organic chemistry as a starting material for the synthesis of other compounds. It is also used in the production of pharmaceuticals and agrochemicals. Additionally, (E)-2-Bromo-2-butenoic acid is a key intermediate in the manufacturing of various chemicals used in industrial processes. Its structure consists of a double bond and a bromine atom, making it an important reagent for organic synthesis and research. Due to its chemical properties and reactivity, proper handling and storage are essential to prevent any potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 36297-22-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,2,9 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 36297-22:
(7*3)+(6*6)+(5*2)+(4*9)+(3*7)+(2*2)+(1*2)=130
130 % 10 = 0
So 36297-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BrO2/c1-2-3(5)4(6)7/h2H,1H3,(H,6,7)/b3-2+
